| Name | Hyperin |
| Synonyms | Hyperin HYPERIN HYPEROSID Hyperosid Hyperasid hyperasid Hyperozide HYPEROSIDE hyperozide Hyperoside NSC 407304 Hyperin (8CI) Quercetin-3-galactoside QUERCETIN-3-D-GALACTOSIDE Quercetin-3-O-galactoside QUERCETIN-3-O-GALACTOSIDE QUERCETIN-3B-D-GALACTOSIDE Quercetin 3-beta-D-galactopyranoside Quercetin 3-O-beta-D-galactopyranoside 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl hexopyranoside 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-chromen-3-yl D-glucopyranoside 2-(3,4-Dihydroxyphenyl)-3-(beta-D-galactopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3-(beta-D-galactopyranosyloxy)-5,7-dihydroxy- |
| CAS | 482-36-0 |
| EINECS | 207-580-6 |
| InChI | InChI=1/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21?/m1/s1 |
| Molecular Formula | C21H20O12 |
| Molar Mass | 464.38 |
| Density | 1.87±0.1 g/cm3(Predicted) |
| Melting Point | 225-226°C |
| Boling Point | 872.6±65.0 °C(Predicted) |
| Specific Rotation(α) | -83°(c=0.2,pyridine) |
| Flash Point | 307.473°C |
| Solubility | Easily soluble in ethanol, methanol, acetone and pyridine. |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | Pale yellow needle crystal |
| Color | Light Yellow to Yellow |
| BRN | 5784795 |
| pKa | 6.17±0.40(Predicted) |
| Storage Condition | -20°C |
| Refractive Index | 1.803 |
| MDL | MFCD00016933 |
| Physical and Chemical Properties | Easily soluble in ethanol, methanol, acetone and pyridine. From the fruits and whole grass of the Hypericaceae family. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R22 - Harmful if swallowed R40 - Limited evidence of a carcinogenic effect |
| Safety Description | S22 - Do not breathe dust. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | DJ3009200 |
| FLUKA BRAND F CODES | 10-23 |
| HS Code | 29389090 |